Difference between revisions of "RIBOSE-1-ARSENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ox-Glutaredoxins == * common-name: ** an oxidized glutaredoxin == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite RIBOSE-1-ARSENATE == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) * inchi-key: ** ryjjomqpaa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RIBOSE-1-ARSENATE == |
* common-name: | * common-name: | ||
− | ** | + | ** ribose-1-arsenate |
+ | * smiles: | ||
+ | ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) | ||
+ | * inchi-key: | ||
+ | ** ryjjomqpaaufbf-txicztdvsa-l | ||
+ | * molecular-weight: | ||
+ | ** 272.043 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7001]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ribose-1-arsenate}} |
+ | {{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}} | ||
+ | {{#set: molecular-weight=272.043}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite RIBOSE-1-ARSENATE
- common-name:
- ribose-1-arsenate
- smiles:
- c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
- inchi-key:
- ryjjomqpaaufbf-txicztdvsa-l
- molecular-weight:
- 272.043