Difference between revisions of "RIBOSE-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FE+2 == * common-name: ** fe2+ * smiles: ** [fe++] * inchi-key: ** cwynvvgooaeacu-uhfffaoysa-n * molecular-weight: ** 55.847 == Reaction(...")
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FE+2 ==
+
== Metabolite RIBOSE-1P ==
 
* common-name:
 
* common-name:
** fe2+
+
** α-d-ribose-1-phosphate
 
* smiles:
 
* smiles:
** [fe++]
+
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
 
* inchi-key:
 
* inchi-key:
** cwynvvgooaeacu-uhfffaoysa-n
+
** yxjdfqjkerbobm-txicztdvsa-l
 
* molecular-weight:
 
* molecular-weight:
** 55.847
+
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-FE+2]]
+
* [[ADENPHOSPHOR-RXN]]
* [[FE2GTPabc]]
+
* [[INOPHOSPHOR-RXN]]
* [[FESO3OXI-RXN]]
+
* [[PNP-RXN]]
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+
* [[PPENTOMUT-RXN]]
* [[PROTOHEMEFERROCHELAT-RXN]]
+
* [[RXN-14456]]
* [[RXN-17518]]
+
* [[RXN0-5199]]
* [[RXN0-1483]]
+
* [[URPHOS-RXN]]
* [[SIROHEME-FERROCHELAT-RXN]]
 
* [[TransportSeed-FE+2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-FE+2]]
+
* [[ADENPHOSPHOR-RXN]]
* [[FE2GTPabc]]
+
* [[INOPHOSPHOR-RXN]]
* [[FESO3OXI-RXN]]
+
* [[PNP-RXN]]
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[PPENTOMUT-RXN]]
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+
* [[RXN-14456]]
* [[PROTOHEMEFERROCHELAT-RXN]]
+
* [[RXN0-5199]]
* [[RXN-15598]]
+
* [[URPHOS-RXN]]
* [[RXN-17523]]
+
* [[XANTHOSINEPHOSPHORY-RXN]]
* [[TransportSeed-FE+2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fe2+}}
+
{{#set: common-name=α-d-ribose-1-phosphate}}
{{#set: inchi-key=inchikey=cwynvvgooaeacu-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
{{#set: molecular-weight=55.847}}
+
{{#set: molecular-weight=228.095}}

Latest revision as of 11:12, 18 March 2021

Metabolite RIBOSE-1P

  • common-name:
    • α-d-ribose-1-phosphate
  • smiles:
    • c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
  • inchi-key:
    • yxjdfqjkerbobm-txicztdvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality