Difference between revisions of "RIBOSE-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04085 == * transcription-direction: ** negative * right-end-position: ** 51042 * left-end-position: ** 40970 * centisome-position: ** 36.536972...")
 
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04085 ==
+
== Metabolite RIBOSE-1P ==
* transcription-direction:
+
* common-name:
** negative
+
** α-d-ribose-1-phosphate
* right-end-position:
+
* smiles:
** 51042
+
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
* left-end-position:
+
* inchi-key:
** 40970
+
** yxjdfqjkerbobm-txicztdvsa-l
* centisome-position:
+
* molecular-weight:
** 36.536972   
+
** 228.095
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ADENPHOSPHOR-RXN]]
== Reaction(s) associated ==
+
* [[INOPHOSPHOR-RXN]]
* [[ATPASE-RXN]]
+
* [[PNP-RXN]]
** Category: [[annotation]]
+
* [[PPENTOMUT-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14456]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN0-5199]]
** Category: [[annotation]]
+
* [[URPHOS-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
* [[RXN-12195]]
+
* [[ADENPHOSPHOR-RXN]]
** Category: [[annotation]]
+
* [[INOPHOSPHOR-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PNP-RXN]]
* [[RXN-12196]]
+
* [[PPENTOMUT-RXN]]
** Category: [[annotation]]
+
* [[RXN-14456]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN0-5199]]
* [[RXN0-5462]]
+
* [[URPHOS-RXN]]
** Category: [[annotation]]
+
* [[XANTHOSINEPHOSPHORY-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) associated ==
+
{{#set: common-name=α-d-ribose-1-phosphate}}
* [[PWY-7210]]
+
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
** '''8''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=228.095}}
* [[PWY-7198]]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7184]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-6545]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=51042}}
 
{{#set: left-end-position=40970}}
 
{{#set: centisome-position=36.536972    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite RIBOSE-1P

  • common-name:
    • α-d-ribose-1-phosphate
  • smiles:
    • c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
  • inchi-key:
    • yxjdfqjkerbobm-txicztdvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality