Difference between revisions of "RIBOSE-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8123 == * common-name: ** moo2-molybdopterin cofactor * smiles: ** c(op([o-])(=o)[o-])c2(c1(s[mo](=o)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)...")
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8123 ==
+
== Metabolite RIBOSE-1P ==
 
* common-name:
 
* common-name:
** moo2-molybdopterin cofactor
+
** α-d-ribose-1-phosphate
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c2(c1(s[mo](=o)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)c(=o)nc(n)=n4))))
+
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
 
* inchi-key:
 
* inchi-key:
** hdajuggarufrou-jsudgwjlsa-j
+
** yxjdfqjkerbobm-txicztdvsa-l
 
* molecular-weight:
 
* molecular-weight:
** 519.251
+
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8351]]
+
* [[ADENPHOSPHOR-RXN]]
 +
* [[INOPHOSPHOR-RXN]]
 +
* [[PNP-RXN]]
 +
* [[PPENTOMUT-RXN]]
 +
* [[RXN-14456]]
 +
* [[RXN0-5199]]
 +
* [[URPHOS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8348]]
+
* [[ADENPHOSPHOR-RXN]]
 +
* [[INOPHOSPHOR-RXN]]
 +
* [[PNP-RXN]]
 +
* [[PPENTOMUT-RXN]]
 +
* [[RXN-14456]]
 +
* [[RXN0-5199]]
 +
* [[URPHOS-RXN]]
 +
* [[XANTHOSINEPHOSPHORY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=moo2-molybdopterin cofactor}}
+
{{#set: common-name=α-d-ribose-1-phosphate}}
{{#set: inchi-key=inchikey=hdajuggarufrou-jsudgwjlsa-j}}
+
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
{{#set: molecular-weight=519.251}}
+
{{#set: molecular-weight=228.095}}

Latest revision as of 11:12, 18 March 2021

Metabolite RIBOSE-1P

  • common-name:
    • α-d-ribose-1-phosphate
  • smiles:
    • c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
  • inchi-key:
    • yxjdfqjkerbobm-txicztdvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality