Difference between revisions of "RIBOSE-5P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PLASMENYLCHOLINE == * common-name: ** a plasmenylcholine == Reaction(s) known to consume the compound == * PLASMALOGEN-SYNTHASE-RXN *...")
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PLASMENYLCHOLINE ==
+
== Metabolite CPD-7025 ==
 
* common-name:
 
* common-name:
** a plasmenylcholine
+
** phytyl monophosphate
 +
* smiles:
 +
** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
 +
* inchi-key:
 +
** yrxrhzokdfcxib-pyddkjgssa-l
 +
* molecular-weight:
 +
** 374.499
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PLASMALOGEN-SYNTHASE-RXN]]
 
* [[RXN-17736]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PLASMALOGEN-SYNTHASE-RXN]]
+
* [[RXN-7683]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a plasmenylcholine}}
+
{{#set: common-name=phytyl monophosphate}}
 +
{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
 +
{{#set: molecular-weight=374.499}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-7025

  • common-name:
    • phytyl monophosphate
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
  • inchi-key:
    • yrxrhzokdfcxib-pyddkjgssa-l
  • molecular-weight:
    • 374.499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality