Difference between revisions of "RIBOSE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11671 == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) * inchi-key: ** kqrohcsyogbqgj-uhfffaoysa-n...") |
(Created page with "Category:metabolite == Metabolite RIBOSE-5P == * common-name: ** d-ribose 5-phosphate == Reaction(s) known to consume the compound == * 1TRANSKETO-RXN * PPENTOMUT-RX...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RIBOSE-5P == |
* common-name: | * common-name: | ||
| − | ** 5- | + | ** d-ribose 5-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1TRANSKETO-RXN]] |
| − | * [[RXN- | + | * [[PPENTOMUT-RXN]] |
| + | * [[PRPPSYN-RXN]] | ||
| + | * [[RIB5PISOM-RXN]] | ||
| + | * [[RXN-12590]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[1TRANSKETO-RXN]] |
| + | * [[PPENTOMUT-RXN]] | ||
| + | * [[PRPPSYN-RXN]] | ||
| + | * [[RIB5PISOM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5- | + | {{#set: common-name=d-ribose 5-phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite RIBOSE-5P
- common-name:
- d-ribose 5-phosphate
