Difference between revisions of "RIBOSYN2-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * common-name: ** d-myo-inositol (1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * common-name: ** 3-sulfinopyruvate * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4)-trisphosphate
+
** 3-sulfinopyruvate
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c(s([o-])=o)c(=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** mmwciqzxvozegg-mlqgymepsa-h
+
** jxylqemxcaamol-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 414.049
+
** 150.106
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.133-RXN]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
* [[2.7.1.139-RXN]]
 
* [[RXN-10939]]
 
* [[RXN-10959]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8730]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
+
{{#set: common-name=3-sulfinopyruvate}}
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
+
{{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}}
{{#set: molecular-weight=414.049}}
+
{{#set: molecular-weight=150.106}}

Revision as of 09:22, 27 August 2019

Metabolite 3-SULFINYL-PYRUVATE

  • common-name:
    • 3-sulfinopyruvate
  • smiles:
    • c(s([o-])=o)c(=o)c(=o)[o-]
  • inchi-key:
    • jxylqemxcaamol-uhfffaoysa-l
  • molecular-weight:
    • 150.106

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality