Difference between revisions of "RIBULOSE-5P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10202 == * transcription-direction: ** positive * right-end-position: ** 3762 * left-end-position: ** 2950 * centisome-position: ** 9.217598 ==...") |
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * smiles: ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o * inchi-key: ** fnzlkvnuwiipsj-uh...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite RIBULOSE-5P == |
− | * | + | * common-name: |
− | ** | + | ** d-ribulose 5-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** fnzlkvnuwiipsj-uhnvwzdzsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 228.095 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[DIOHBUTANONEPSYN-RXN]] | |
− | == Reaction(s) | + | * [[PHOSPHORIBULOKINASE-RXN]] |
− | * [[ | + | * [[RIB5PISOM-RXN]] |
− | * | + | * [[RIBULP3EPIM-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[6PGLUCONDEHYDROG-RXN]] |
− | + | * [[PHOSPHORIBULOKINASE-RXN]] | |
− | * | + | * [[RIB5PISOM-RXN]] |
− | * [[RXN | + | * [[RIBULP3EPIM-RXN]] |
− | * | + | * [[RXN-3341]] |
− | * | + | * [[RXN-9952]] |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=d-ribulose 5-phosphate}} |
− | + | {{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}} | |
− | + | {{#set: molecular-weight=228.095}} | |
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite RIBULOSE-5P
- common-name:
- d-ribulose 5-phosphate
- smiles:
- c(c(c(c(co)=o)o)o)op([o-])([o-])=o
- inchi-key:
- fnzlkvnuwiipsj-uhnvwzdzsa-l
- molecular-weight:
- 228.095