Difference between revisions of "RNA-DNA-hybrids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3061 == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) * inchi-key: ** furuxtvzlhccn...") |
(Created page with "Category:metabolite == Metabolite RNA-DNA-hybrids == * common-name: ** a rna-dna hybrid == Reaction(s) known to consume the compound == * 3.1.26.4-RXN == Reaction(s) k...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RNA-DNA-hybrids == |
* common-name: | * common-name: | ||
− | ** | + | ** a rna-dna hybrid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.1.26.4-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a rna-dna hybrid}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite RNA-DNA-hybrids
- common-name:
- a rna-dna hybrid