Difference between revisions of "RNA-DNA-hybrids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15830 RXN-15830] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite CPD-3061 == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) * inchi-key: ** furuxtvzlhccn...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15830 RXN-15830] ==
+
== Metabolite CPD-3061 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (2s)-liquiritigenin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.9.3.1 ec-1.9.3.1]
+
** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
−
== Reaction formula ==
+
* inchi-key:
−
* 4 [[Cytochromes-C-Reduced]][e] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 8 [[PROTON]][c] '''=>''' 4 [[Cytochromes-C-Oxidized]][e] '''+''' 4 [[PROTON]][e] '''+''' 2 [[WATER]][c]
+
** furuxtvzlhccna-aweznqclsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06150]]
+
** 256.257
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-3221]]
−
* [[PWY-6692]], Fe(II) oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6692 PWY-6692]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
{{#set: common-name=(2s)-liquiritigenin}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=furuxtvzlhccna-aweznqclsa-n}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=256.257}}
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.9.3.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-3061

  • common-name:
    • (2s)-liquiritigenin
  • smiles:
    • c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o)
  • inchi-key:
    • furuxtvzlhccna-aweznqclsa-n
  • molecular-weight:
    • 256.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=RNA-DNA-hybrids&oldid=47823"