Difference between revisions of "RNA-Holder"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * smiles: ** co * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * molecular-weight: ** 32.042 == Reaction...") |
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_I == * common-name: ** coproporphyrinogen i * smiles: ** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite COPROPORPHYRINOGEN_I == |
* common-name: | * common-name: | ||
− | ** | + | ** coproporphyrinogen i |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wiuggjkhyqignh-uhfffaoysa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 656.734 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-10642]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=coproporphyrinogen i}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=656.734}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite COPROPORPHYRINOGEN_I
- common-name:
- coproporphyrinogen i
- smiles:
- cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
- inchi-key:
- wiuggjkhyqignh-uhfffaoysa-j
- molecular-weight:
- 656.734