Difference between revisions of "RNA-Holder"

Latest revision as of 11:11, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite COPROPORPHYRINOGEN_I ==
+== Metabolite RNA-Holder ==
 * common-name:
-** coproporphyrinogen i
+** a ribonucleic acid
-* smiles:
-** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
-* inchi-key:
-** wiuggjkhyqignh-uhfffaoysa-j
-* molecular-weight:
-** 656.734
 == Reaction(s) known to consume the compound ==
+* [[3.1.27.1-RXN]]
+* [[3.1.27.5-RXN]]
+* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
+* [[RNA-URIDYLYLTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10642]]
+* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+* [[RNA-DIRECTED-RNA-POLYMERASE-RXN]]
+* [[RNA-LIGASE-ATP-RXN]]
+* [[RNA-URIDYLYLTRANSFERASE-RXN]]
+* [[RXN-17927]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=coproporphyrinogen i}}
+{{#set: common-name=a ribonucleic acid}}
-{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}
-{{#set: molecular-weight=656.734}}