Difference between revisions of "RNA-Ligase-L-lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...") |
(Created page with "Category:metabolite == Metabolite RNA-Ligase-L-lysine == * common-name: ** an [rna ligase]-l-lysine == Reaction(s) known to consume the compound == * RXN-17925 == Reac...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RNA-Ligase-L-lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** an [rna ligase]-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17925]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17926]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an [rna ligase]-l-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite RNA-Ligase-L-lysine
- common-name:
- an [rna ligase]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [rna ligase]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
