Difference between revisions of "RNA-Ligase-L-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...")
(Created page with "Category:metabolite == Metabolite Charged-ILE-tRNAs == * common-name: ** an l-isoleucyl-[trnaile] == Reaction(s) known to consume the compound == == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10244 ==
+
== Metabolite Charged-ILE-tRNAs ==
 
* common-name:
 
* common-name:
** docosahexaenoate
+
** an l-isoleucyl-[trnaile]
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
 
* inchi-key:
 
** mbmbgcfofbjsgt-kubavdmbsa-m
 
* molecular-weight:
 
** 327.486
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16063]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16017]]
+
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
* [[RXN-16063]]
 
* [[RXN-16138]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=docosahexaenoate}}
+
{{#set: common-name=an l-isoleucyl-[trnaile]}}
{{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}}
 
{{#set: molecular-weight=327.486}}
 

Revision as of 13:12, 14 January 2021

Metabolite Charged-ILE-tRNAs

  • common-name:
    • an l-isoleucyl-[trnaile]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-isoleucyl-[trnaile" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.