Difference between revisions of "RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASP-tRNAs == * common-name: ** trnaasp == Reaction(s) known to consume the compound == * ASPARTATE--TRNA-LIGASE-RXN == Reaction(s) kn...")
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o * inchi-key: ** zwzwygmenqvnfu-u...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ASP-tRNAs ==
+
== Metabolite CPD0-2030 ==
 
* common-name:
 
* common-name:
** trnaasp
+
** glycerophosphoserine
 +
* smiles:
 +
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
 +
* inchi-key:
 +
** zwzwygmenqvnfu-uhnvwzdzsa-m
 +
* molecular-weight:
 +
** 258.144
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARTATE--TRNA-LIGASE-RXN]]
+
* [[RXN-14136]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trnaasp}}
+
{{#set: common-name=glycerophosphoserine}}
 +
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
 +
{{#set: molecular-weight=258.144}}

Revision as of 11:15, 15 January 2021

Metabolite CPD0-2030

  • common-name:
    • glycerophosphoserine
  • smiles:
    • c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
  • inchi-key:
    • zwzwygmenqvnfu-uhnvwzdzsa-m
  • molecular-weight:
    • 258.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality