Difference between revisions of "RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13394 == * common-name: ** glycyl-l-glutamine * smiles: ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** pnmuaggsdzxthx-bypyzucns...") |
(Created page with "Category:metabolite == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == * common-name: ** rnase ii substrate with no poly-a tail == Reaction(s) known to consume the co...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == |
* common-name: | * common-name: | ||
| − | ** | + | ** rnase ii substrate with no poly-a tail |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-6524]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=rnase ii substrate with no poly-a tail}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL
- common-name:
- rnase ii substrate with no poly-a tail
