Difference between revisions of "RNASE-III-PROCESSING-PRODUCT-MRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * smiles: ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) * inchi-key: ** ltqypavlayvkt...") |
(Created page with "Category:metabolite == Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA == * common-name: ** rnase iii processing product mrna == Reaction(s) known to consume the compound ==...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA == |
* common-name: | * common-name: | ||
− | ** | + | ** rnase iii processing product mrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.1.26.3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=rnase iii processing product mrna}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA
- common-name:
- rnase iii processing product mrna