Difference between revisions of "RNASE-III-PROCESSING-PRODUCT-MRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.93-RXN 4.2.1.93-RXN] == * direction: ** left-to-right * common-name: ** atp-dependent nadh-hy...")
(Created page with "Category:metabolite == Metabolite CPD-13559 == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o)o1) * inchi-key: ** wqzgkkkjijffok-pqmkyfcfsa-...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.93-RXN 4.2.1.93-RXN] ==
+
== Metabolite CPD-13559 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** atp-dependent nadh-hydrate dehydratase
+
** α-d-mannopyranose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.93 ec-4.2.1.93]
+
** c(o)c1(c(o)c(o)c(o)c(o)o1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-653]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** wqzgkkkjijffok-pqmkyfcfsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ04267]]
+
** 180.157
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[3.2.1.24-RXN]]
−
* [[PWY-6938]], NADH repair: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6938 PWY-6938]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=α-d-mannopyranose}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=wqzgkkkjijffok-pqmkyfcfsa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=180.157}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19018 19018]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00129 R00129]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=atp-dependent nadh-hydrate dehydratase}}
 
−
{{#set: ec-number=ec-4.2.1.93}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-13559

  • common-name:
    • α-d-mannopyranose
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o)o1)
  • inchi-key:
    • wqzgkkkjijffok-pqmkyfcfsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=RNASE-III-PROCESSING-PRODUCT-MRNA&oldid=47437"