Difference between revisions of "RXN-15830"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...")
(Created page with "Category:reaction == Reaction RXN-15830 == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1.9.3.1 ec-1.9.3.1] == Reaction formula == * 4 Cyto...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite G3P ==
+
== Reaction RXN-15830 ==
* common-name:
+
* direction:
** 3-phospho-d-glycerate
+
** left-to-right
* smiles:
+
* ec-number:
** c(op(=o)([o-])[o-])c(o)c(=o)[o-]
+
** [http://enzyme.expasy.org/EC/1.9.3.1 ec-1.9.3.1]
* inchi-key:
+
== Reaction formula ==
** osjppgntcrnqqc-uwtatzphsa-k
+
* 4 [[Cytochromes-C-Reduced]][e] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 8 [[PROTON]][c] '''=>''' 4 [[Cytochromes-C-Oxidized]][e] '''+''' 4 [[PROTON]][e] '''+''' 2 [[WATER]][c]
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
** 183.034
+
* Gene: [[SJ06150]]
== Reaction(s) known to consume the compound ==
+
** Category: [[orthology]]
* [[3PGAREARR-RXN]]
+
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
* [[PGLYCDEHYDROG-RXN]]
+
== Pathway(s)  ==
* [[PHOSGLYPHOS-RXN]]
+
* [[PWY-6692]], Fe(II) oxidation:
* [[RXN-15511]]
+
** '''3''' reactions found over '''6''' reactions in the full pathway
* [[RXN-15513]]
+
== Reconstruction information  ==
* [[RXN-17276]]
+
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
== External links  ==
* [[3PGAREARR-RXN]]
+
{{#set: direction=left-to-right}}
* [[GLY3KIN-RXN]]
+
{{#set: ec-number=ec-1.9.3.1}}
* [[PGLYCDEHYDROG-RXN]]
+
{{#set: nb gene associated=1}}
* [[PHOSGLYPHOS-RXN]]
+
{{#set: nb pathway associated=1}}
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
+
{{#set: reconstruction category=orthology}}
* [[RXN-15511]]
+
{{#set: reconstruction tool=pantograph}}
* [[RXN-15513]]
+
{{#set: reconstruction comment=n.a}}
* [[RXN-17274]]
+
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
* [[RXN-3443]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3-phospho-d-glycerate}}
 
{{#set: inchi-key=inchikey=osjppgntcrnqqc-uwtatzphsa-k}}
 
{{#set: molecular-weight=183.034}}
 

Latest revision as of 11:18, 18 March 2021

Reaction RXN-15830

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-6692, Fe(II) oxidation:
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links