Difference between revisions of "RXN-15830"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite G3P == * common-name: ** 3-phospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(o)c(=o)[o-] * inchi-key: ** osjppgntcrnqqc-uwtatzphsa-k...") |
(Created page with "Category:reaction == Reaction RXN-15830 == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1.9.3.1 ec-1.9.3.1] == Reaction formula == * 4 Cyto...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:reaction]] |
− | == | + | == Reaction RXN-15830 == |
− | * | + | * direction: |
− | ** | + | ** left-to-right |
− | * | + | * ec-number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.9.3.1 ec-1.9.3.1] |
− | + | == Reaction formula == | |
− | + | * 4 [[Cytochromes-C-Reduced]][e] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 8 [[PROTON]][c] '''=>''' 4 [[Cytochromes-C-Oxidized]][e] '''+''' 4 [[PROTON]][e] '''+''' 2 [[WATER]][c] | |
− | + | == Gene(s) associated with this reaction == | |
− | + | * Gene: [[SJ06150]] | |
− | == Reaction | + | ** Category: [[orthology]] |
− | * [[ | + | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a |
− | + | == Pathway(s) == | |
− | + | * [[PWY-6692]], Fe(II) oxidation: | |
− | + | ** '''3''' reactions found over '''6''' reactions in the full pathway | |
− | + | == Reconstruction information == | |
− | + | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
− | == | + | == External links == |
− | * [[ | + | {{#set: direction=left-to-right}} |
− | * [[ | + | {{#set: ec-number=ec-1.9.3.1}} |
− | * [[ | + | {{#set: nb gene associated=1}} |
− | + | {{#set: nb pathway associated=1}} | |
− | * [[ | + | {{#set: reconstruction category=orthology}} |
− | * | + | {{#set: reconstruction tool=pantograph}} |
− | * [[ | + | {{#set: reconstruction comment=n.a}} |
− | + | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}} | |
− | |||
− | == | ||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:18, 18 March 2021
Contents
Reaction RXN-15830
- direction:
- left-to-right
- ec-number:
Reaction formula
- 4 Cytochromes-C-Reduced[e] + 1 OXYGEN-MOLECULE[c] + 8 PROTON[c] => 4 Cytochromes-C-Oxidized[e] + 4 PROTON[e] + 2 WATER[c]
Gene(s) associated with this reaction
- Gene: SJ06150
- Category: orthology
- Source: output_pantograph_ectocarpus_siliculosus, Tool: pantograph, Assignment: n.a, Comment: n.a
- Category: orthology
Pathway(s)
- PWY-6692, Fe(II) oxidation:
- 3 reactions found over 6 reactions in the full pathway
Reconstruction information
- category: orthology; source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a