Difference between revisions of "Receptor-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLEYL-CPD == * common-name: ** (indole-3-yl)acetonitrile * smiles: ** c(#n)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** dmcpfobljmlsnx-uhfff...") |
(Created page with "Category:metabolite == Metabolite Receptor-proteins == * common-name: ** a receptor protein == Reaction(s) known to consume the compound == * 2.7.11.30-RXN == Reaction...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Receptor-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a receptor protein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.7.11.30-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.7.11.30-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a receptor protein}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Receptor-proteins
- common-name:
- a receptor protein
