Difference between revisions of "Red-NADPH-Hemoprotein-Reductases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Red-NADPH-Hemoprotein-Reductases == * common-name: ** a reduced [nadph-hemoprotein reductase] == Reaction(s) known to consume the compoun...")
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Red-NADPH-Hemoprotein-Reductases ==
+
== Metabolite 1-L-MYO-INOSITOL-1-P ==
 
* common-name:
 
* common-name:
** a reduced [nadph-hemoprotein reductase]
+
** 1d-myo-inositol 3-monophosphate
 +
* smiles:
 +
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 +
* inchi-key:
 +
** inapmgsxuvuwaf-ptqmnwpwsa-l
 +
* molecular-weight:
 +
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
* [[RXN-11056]]
+
* [[RXN-6501]]
* [[RXN-11057]]
 
* [[RXN-13064]]
 
* [[RXN-17625]]
 
* [[RXN-17627]]
 
* [[RXN-8630]]
 
* [[RXN-8872]]
 
* [[RXN66-146]]
 
* [[RXN66-161]]
 
* [[RXN66-163]]
 
* [[RXN66-169]]
 
* [[RXN66-181]]
 
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17627]]
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[RXN-10960]]
 +
* [[RXN66-579]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a reduced [nadph-hemoprotein reductase]}}
+
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
 +
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 11:16, 15 January 2021

Metabolite 1-L-MYO-INOSITOL-1-P

  • common-name:
    • 1d-myo-inositol 3-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-ptqmnwpwsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality