Difference between revisions of "Red-NADPH-Hemoprotein-Reductases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * smiles: ** c([o-])(=o)c(cccc(c([o-])=o...")
(Created page with "Category:metabolite == Metabolite Red-NADPH-Hemoprotein-Reductases == * common-name: ** a reduced [nadph-hemoprotein reductase] == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE ==
+
== Metabolite Red-NADPH-Hemoprotein-Reductases ==
 
* common-name:
 
* common-name:
** l-α-amino-ε-keto-pimelate
+
** a reduced [nadph-hemoprotein reductase]
* smiles:
 
** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
 
* inchi-key:
 
** ukcsfklwnhubdy-bypyzucnsa-m
 
* molecular-weight:
 
** 188.16
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 +
* [[RXN-11056]]
 +
* [[RXN-11057]]
 +
* [[RXN-13064]]
 +
* [[RXN-17625]]
 +
* [[RXN-17627]]
 +
* [[RXN-8630]]
 +
* [[RXN-8872]]
 +
* [[RXN66-146]]
 +
* [[RXN66-161]]
 +
* [[RXN66-163]]
 +
* [[RXN66-169]]
 +
* [[RXN66-181]]
 +
* [[SQUALENE-MONOOXYGENASE-RXN]]
 +
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+
* [[RXN-17627]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-α-amino-ε-keto-pimelate}}
+
{{#set: common-name=a reduced [nadph-hemoprotein reductase]}}
{{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}}
 
{{#set: molecular-weight=188.16}}
 

Revision as of 18:56, 14 January 2021

Metabolite Red-NADPH-Hemoprotein-Reductases

  • common-name:
    • a reduced [nadph-hemoprotein reductase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a reduced [nadph-hemoprotein reductase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.