Difference between revisions of "Red-Thioredoxin"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite Red-Thioredoxin == * common-name: ** a reduced thioredoxin == Reaction(s) known to consume the compound == * 1.17.4.2-RXN * 1.8.4.1...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11403 ==
+
== Metabolite Red-Thioredoxin ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate
+
** a reduced thioredoxin
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
 
* inchi-key:
 
** ppjyssnksxavdb-uhfffaoysa-m
 
* molecular-weight:
 
** 746.825
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10616]]
+
* [[1.17.4.2-RXN]]
* [[RXN-10617]]
+
* [[1.8.4.12-RXN]]
 +
* [[1.8.4.14-RXN]]
 +
* [[1.8.4.8-RXN]]
 +
* [[ADPREDUCT-RXN]]
 +
* [[CDPREDUCT-RXN]]
 +
* [[DAOTO]]
 +
* [[DCDT]]
 +
* [[DGOTO]]
 +
* [[DUDT]]
 +
* [[GDPREDUCT-RXN]]
 +
* [[MERCAPYSTRANS-RXN]]
 +
* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 +
* [[RXN-12019]]
 +
* [[RXN-8668]]
 +
* [[RXN0-267]]
 +
* [[RXN0-5468]]
 +
* [[UDPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.8.4.12-RXN]]
 +
* [[1.8.4.8-RXN]]
 +
* [[TDSR]]
 +
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate}}
+
{{#set: common-name=a reduced thioredoxin}}
{{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}}
 
{{#set: molecular-weight=746.825}}
 

Latest revision as of 11:16, 18 March 2021