Difference between revisions of "Reduced-2Fe-2S-Ferredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-L-RHAMNOSE == * common-name: ** udp-β-l-rhamnose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-]...")
(Created page with "Category:metabolite == Metabolite tRNAPhe-Containing-N1-Methylguanine-37 == * common-name: ** an n1-methylguanine37 in trnaphe == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-L-RHAMNOSE ==
+
== Metabolite tRNAPhe-Containing-N1-Methylguanine-37 ==
 
* common-name:
 
* common-name:
** udp-β-l-rhamnose
+
** an n1-methylguanine37 in trnaphe
* smiles:
 
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
 
* inchi-key:
 
** drdcjeizvlvwnc-slbwpepysa-l
 
* molecular-weight:
 
** 548.29
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10740]]
+
* [[RXN-14517]]
* [[RXN-5482]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-β-l-rhamnose}}
+
{{#set: common-name=an n1-methylguanine37 in trnaphe}}
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
 
{{#set: molecular-weight=548.29}}
 

Revision as of 15:25, 5 January 2021

Metabolite tRNAPhe-Containing-N1-Methylguanine-37

  • common-name:
    • an n1-methylguanine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality