Difference between revisions of "Reduced-Rubredoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...") |
(Created page with "Category:metabolite == Metabolite Reduced-Rubredoxins == * common-name: ** a reduced rubredoxin == Reaction(s) known to consume the compound == * ALKANE-1-MONOOXYGENASE-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Reduced-Rubredoxins == |
* common-name: | * common-name: | ||
− | ** | + | ** a reduced rubredoxin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ALKANE-1-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a reduced rubredoxin}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Reduced-Rubredoxins
- common-name:
- a reduced rubredoxin