Difference between revisions of "Reduced-Rubredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8347 == * common-name: ** 1-18:2-2-lysophosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o * i...")
(Created page with "Category:metabolite == Metabolite CDPDIACYLGLYCEROL == * common-name: ** a cdp-diacylglycerol == Reaction(s) known to consume the compound == * 2.7.8.11-RXN * PHOSPH...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8347 ==
+
== Metabolite CDPDIACYLGLYCEROL ==
 
* common-name:
 
* common-name:
** 1-18:2-2-lysophosphatidylcholine
+
** a cdp-diacylglycerol
* smiles:
 
** cccccc=ccc=ccccccccc(occ(o)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** spjfyyjxnpezdw-ftjopakqsa-n
 
* molecular-weight:
 
** 519.657
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.8.11-RXN]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
* [[PHOSPHASERSYN-RXN]]
 +
* [[RXN-8141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12430]]
+
* [[CDPDIGLYSYN-RXN]]
 +
* [[PHOSPHASERSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-lysophosphatidylcholine}}
+
{{#set: common-name=a cdp-diacylglycerol}}
{{#set: inchi-key=inchikey=spjfyyjxnpezdw-ftjopakqsa-n}}
 
{{#set: molecular-weight=519.657}}
 

Revision as of 13:09, 14 January 2021

Metabolite CDPDIACYLGLYCEROL

  • common-name:
    • a cdp-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality