Difference between revisions of "Reduced-cytochromes-c551"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.61-RXN 4.2.1.61-RXN] == * direction: ** left-to-right * common-name: ** fatty acid synthase *...")
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.61-RXN 4.2.1.61-RXN] ==
+
== Metabolite ASN ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** fatty acid synthase
+
** l-asparagine
−
** (3r)-3-hydroxypalmitoyl-[acyl-carrier protein] dehydratase
+
* smiles:
−
* ec-number:
+
** c(cc(c(=o)[o-])[n+])(n)=o
−
** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86]
+
* inchi-key:
−
** [http://enzyme.expasy.org/EC/2.3.1.85 ec-2.3.1.85]
+
** dcxyfedjocdnaf-reohclbhsa-n
−
** [http://enzyme.expasy.org/EC/4.2.1.59 ec-4.2.1.59]
+
* molecular-weight:
−
* synonymous:
+
** 132.119
−
** (3r)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase (hexadec-2-enoyl-[acyl-carrier protein]-forming)
+
== Reaction(s) known to consume the compound ==
−
** (3r)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase
+
* [[ASPARAGHYD-RXN]]
−
** β-hydroxypalmitoyl-acyl carrier protein dehydrase
+
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
−
** β-hydroxypalmitoyl thioester dehydratase
+
* [[biomass_rxn]]
−
** d-3-hydroxypalmitoyl-[acyl-carrier-protein] dehydratase
+
== Reaction(s) known to produce the compound ==
−
** β-hydroxypalmityl-acp dehydrase
+
* [[ASNSYNA-RXN]]
−
== Reaction formula ==
+
* [[ASNSYNB-RXN]]
−
* 1 [[R-3-Hydroxypalmitoyl-ACPs]][c] '''=>''' 1 [[2-Hexadecenoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-12460]]
−
== Gene(s) associated with this reaction  ==
+
* [[RXN0-6982]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ04769]]
+
{{#set: common-name=l-asparagine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=132.119}}
−
* Gene: [[SJ10275]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ15983]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ04443]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06944]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06617]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ13014]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ03883]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ18059]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ19629]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ00320]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06616]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ11672]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ00613]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ10624]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ17743]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 
−
** '''31''' reactions found over '''31''' reactions in the full pathway
 
−
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 
−
** '''31''' reactions found over '''31''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04462 R04462]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P49327 P49327]
 
−
** [http://www.uniprot.org/uniprot/P07149 P07149]
 
−
** [http://www.uniprot.org/uniprot/P12276 P12276]
 
−
** [http://www.uniprot.org/uniprot/P12785 P12785]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=fatty acid synthase|(3r)-3-hydroxypalmitoyl-[acyl-carrier protein] dehydratase}}
 
−
{{#set: ec-number=ec-2.3.1.86|ec-4.2.1.59|ec-2.3.1.85}}
 
−
{{#set: synonymous=&beta;-hydroxypalmitoyl-acyl carrier protein dehydrase|(3r)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase (hexadec-2-enoyl-[acyl-carrier protein]-forming)|&beta;-hydroxypalmitoyl thioester dehydratase|&beta;-hydroxypalmityl-acp dehydrase|d-3-hydroxypalmitoyl-[acyl-carrier-protein] dehydratase|(3r)-3-hydroxypalmitoyl-[acyl-carrier-protein] hydro-lyase}}
 
−
{{#set: nb gene associated=16}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite ASN

  • common-name:
    • l-asparagine
  • smiles:
    • c(cc(c(=o)[o-])[n+])(n)=o
  • inchi-key:
    • dcxyfedjocdnaf-reohclbhsa-n
  • molecular-weight:
    • 132.119

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Reduced-cytochromes-c551&oldid=48517"