Difference between revisions of "Reduced-ferredoxins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...") |
(Created page with "Category:metabolite == Metabolite CHOLATE == * common-name: ** cholate * smiles: ** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](cc(o)c(c)23)4)))) * inch...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CHOLATE == |
* common-name: | * common-name: | ||
− | ** | + | ** cholate |
* smiles: | * smiles: | ||
− | ** ccc( | + | ** cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](cc(o)c(c)23)4)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bhqcqffyrzlcqq-oeldtzbjsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 407.569 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[7-ALPHA-HYDROXYSTEROID-DEH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cholate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bhqcqffyrzlcqq-oeldtzbjsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=407.569}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CHOLATE
- common-name:
- cholate
- smiles:
- cc(ccc(=o)[o-])[ch]2(cc[ch]3([ch]4(c(o)c[ch]1(cc(o)ccc(c)1[ch](cc(o)c(c)23)4))))
- inchi-key:
- bhqcqffyrzlcqq-oeldtzbjsa-m
- molecular-weight:
- 407.569