Difference between revisions of "Reduced-flavodoxins"

Revision as of 13:10, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite DIAMINONONANOATE ==
+== Metabolite 5-METHYLTHIOADENOSINE ==
 * common-name:
-** 7,8-diaminopelargonate
+** s-methyl-5'-thioadenosine
 * smiles:
-** cc(c(cccccc([o-])=o)[n+])[n+]
+** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
 * inchi-key:
-** kcegbpiygiwcdh-uhfffaoysa-o
+** wuugfsxjnotrmr-ioslpcccsa-n
 * molecular-weight:
-** 189.277
+** 297.331
 == Reaction(s) known to consume the compound ==
-* [[DAPASYN-RXN]]
+* [[M5TAP]]
-* [[DETHIOBIOTIN-SYN-RXN]]
+* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+* [[RXN-11190]]
+* [[SPERMIDINESYN-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[DAPASYN-RXN]]
+* [[4.4.1.14-RXN]]
+* [[APAPT]]
+* [[RXN-11190]]
+* [[RXN-11371]]
+* [[RXN-14518]]
+* [[RXN0-5217]]
+* [[SPERMIDINESYN-RXN]]
+* [[SPERMINE-SYNTHASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=7,8-diaminopelargonate}}
+{{#set: common-name=s-methyl-5'-thioadenosine}}
-{{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}}
+{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
-{{#set: molecular-weight=189.277}}
+{{#set: molecular-weight=297.331}}