Difference between revisions of "Reduced-flavodoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite AMMONIUM == * common-name: ** ammonium * smiles: ** [nh4+] * inchi-key: ** qgzkdvfqnngyky-uhfffaoysa-o * molecular-weight: ** 18.038 == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-METHYLTHIOADENOSINE ==
+
== Metabolite AMMONIUM ==
 
* common-name:
 
* common-name:
** s-methyl-5'-thioadenosine
+
** ammonium
 
* smiles:
 
* smiles:
** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** [nh4+]
 
* inchi-key:
 
* inchi-key:
** wuugfsxjnotrmr-ioslpcccsa-n
+
** qgzkdvfqnngyky-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 297.331
+
** 18.038
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[M5TAP]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+
* [[ADP-DEAMINASE-RXN]]
* [[RXN-11190]]
+
* [[ALANINE-DEHYDROGENASE-RXN]]
* [[SPERMIDINESYN-RXN]]
+
* [[ASNSYNA-RXN]]
 +
* [[ATP-DEAMINASE-RXN]]
 +
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
 +
* [[GCVT-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GMP-SYN-NH3-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 +
* [[OMEGA-AMIDASE-RXN]]
 +
* [[RXN-10756]]
 +
* [[RXN-12590]]
 +
* [[RXN-13202]]
 +
* [[RXN-13996]]
 +
* [[RXN-13997]]
 +
* [[RXN-14246]]
 +
* [[RXN-14325]]
 +
* [[RXN-16910]]
 +
* [[RXN-17900]]
 +
* [[RXN-9615]]
 +
* [[UREASE-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.4.1.14-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[APAPT]]
+
* [[1.4.3.19-RXN]]
* [[RXN-11190]]
+
* [[4.1.99.4-RXN]]
* [[RXN-11371]]
+
* [[4.3.1.17-RXN]]
* [[RXN-14518]]
+
* [[ADDALT-RXN]]
* [[RXN0-5217]]
+
* [[ADENODEAMIN-RXN]]
* [[SPERMIDINESYN-RXN]]
+
* [[ADP-DEAMINASE-RXN]]
* [[SPERMINE-SYNTHASE-RXN]]
+
* [[AGMATINE-DEIMINASE-RXN]]
 +
* [[ALANINE-DEHYDROGENASE-RXN]]
 +
* [[ALLOPHANATE-HYDROLASE-RXN]]
 +
* [[AMIDASE-RXN]]
 +
* [[AMP-DEAMINASE-RXN]]
 +
* [[ARG-OXIDATION-RXN]]
 +
* [[ASPARAGHYD-RXN]]
 +
* [[ATP-DEAMINASE-RXN]]
 +
* [[BETA-UREIDOPROPIONASE-RXN]]
 +
* [[CYSTHIOCYS-RXN]]
 +
* [[CYTIDEAM-RXN]]
 +
* [[CYTIDEAM2-RXN]]
 +
* [[DCMP-DEAMINASE-RXN]]
 +
* [[DCYSDESULF-RXN]]
 +
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 +
* [[DSERDEAM-RXN]]
 +
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
 +
* [[GCVT-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GMP-REDUCT-RXN]]
 +
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
 +
* [[GUANINE-DEAMINASE-RXN]]
 +
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
 +
* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
 +
* [[HOMOSERDEAM-RXN]]
 +
* [[L-AMINO-ACID-OXIDASE-RXN]]
 +
* [[LCYSDESULF-RXN]]
 +
* [[METBALT-RXN]]
 +
* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
 +
* [[OHMETHYLBILANESYN-RXN]]
 +
* [[OMEGA-AMIDASE-RXN]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[PMPOXI-RXN]]
 +
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
 +
* [[PYRAZIN-RXN]]
 +
* [[R311-RXN]]
 +
* [[RIBOFLAVINSYNDEAM-RXN]]
 +
* [[RXN-1]]
 +
* [[RXN-10032]]
 +
* [[RXN-10756]]
 +
* [[RXN-10778]]
 +
* [[RXN-10817]]
 +
* [[RXN-10907]]
 +
* [[RXN-10910]]
 +
* [[RXN-11067]]
 +
* [[RXN-11210]]
 +
* [[RXN-12613]]
 +
* [[RXN-12729]]
 +
* [[RXN-12878]]
 +
* [[RXN-12893]]
 +
* [[RXN-12894]]
 +
* [[RXN-12895]]
 +
* [[RXN-13996]]
 +
* [[RXN-13997]]
 +
* [[RXN-1401]]
 +
* [[RXN-1404]]
 +
* [[RXN-14246]]
 +
* [[RXN-14727]]
 +
* [[RXN-14728]]
 +
* [[RXN-15130]]
 +
* [[RXN-15261]]
 +
* [[RXN-17608]]
 +
* [[RXN-5821]]
 +
* [[RXN-6763]]
 +
* [[RXN-8672]]
 +
* [[RXN-9615]]
 +
* [[RXN0-6377]]
 +
* [[RXN6666-4]]
 +
* [[RXNN-404]]
 +
* [[THREDEHYD-RXN]]
 +
* [[UREASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-methyl-5'-thioadenosine}}
+
{{#set: common-name=ammonium}}
{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
+
{{#set: inchi-key=inchikey=qgzkdvfqnngyky-uhfffaoysa-o}}
{{#set: molecular-weight=297.331}}
+
{{#set: molecular-weight=18.038}}

Revision as of 18:55, 14 January 2021

Metabolite AMMONIUM

  • common-name:
    • ammonium
  • smiles:
    • [nh4+]
  • inchi-key:
    • qgzkdvfqnngyky-uhfffaoysa-o
  • molecular-weight:
    • 18.038

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality