Difference between revisions of "Reduced-hemoproteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...") |
(Created page with "Category:metabolite == Metabolite Reduced-hemoproteins == * common-name: ** a reduced hemoprotein == Reaction(s) known to consume the compound == == Reaction(s) known to p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Reduced-hemoproteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a reduced hemoprotein |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a reduced hemoprotein}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Reduced-hemoproteins
- common-name:
- a reduced hemoprotein
