Difference between revisions of "Relaxed-DNAs"

Revision as of 11:18, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-ORNITHINE ==
+== Metabolite 3-HYDROHYDROXYPHOSPHORYLPYRUVATE ==
 * common-name:
-** l-ornithine
+** 3-(hydroxyphosphinoyl)pyruvate
 * smiles:
-** c(=o)([o-])c([n+])ccc[n+]
+** c([o-])(=o)c(=o)c[ph]([o-])=o
 * inchi-key:
-** ahlphdhhmvztml-bypyzucnsa-o
+** vhafwrwghgszdl-uhfffaoysa-l
 * molecular-weight:
-** 133.17
+** 150.027
 == Reaction(s) known to consume the compound ==
-* [[ACETYLORNDEACET-RXN]]
+* [[2.7.8.23-RXN]]
-* [[ARGINASE-RXN]]
-* [[ORDC]]
-* [[ORNCARBAMTRANSFER-RXN]]
-* [[ORNDECARBOX-RXN]]
-* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
-* [[ORNITHINE-CYCLODEAMINASE-RXN]]
-* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
-* [[RXN-13482]]
-* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[ACETYLORNDEACET-RXN]]
+* [[2.7.8.23-RXN]]
-* [[AODAA]]
+* [[RXN-10828]]
-* [[ARGINASE-RXN]]
-* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
-* [[ORNCARBAMTRANSFER-RXN]]
-* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
-* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
-* [[RXN-13482]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-ornithine}}
+{{#set: common-name=3-(hydroxyphosphinoyl)pyruvate}}
-{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
+{{#set: inchi-key=inchikey=vhafwrwghgszdl-uhfffaoysa-l}}
-{{#set: molecular-weight=133.17}}
+{{#set: molecular-weight=150.027}}