Difference between revisions of "Relaxed-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12120 == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:metabolite == Metabolite Relaxed-DNAs == * common-name: ** a relaxed dna == Reaction(s) known to consume the compound == * 5.99.1.2-RXN == Reaction(s) known t...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12120 ==
+
== Metabolite Relaxed-DNAs ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-11
+
** a relaxed dna
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 
* inchi-key:
 
** wvrzwraihitkpi-sokmhqjssa-n
 
* molecular-weight:
 
** 909.472
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9362]]
+
* [[5.99.1.2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[5.99.1.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-11}}
+
{{#set: common-name=a relaxed dna}}
{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
 
{{#set: molecular-weight=909.472}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Relaxed-DNAs

  • common-name:
    • a relaxed dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality