Difference between revisions of "Relaxed-DNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-97 == * common-name: ** gibberellin a15 (open lactone form) * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])...")
(Created page with "Category:metabolite == Metabolite CPD-12120 == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-97 ==
+
== Metabolite CPD-12120 ==
 
* common-name:
 
* common-name:
** gibberellin a15 (open lactone form)
+
** demethylmenaquinol-11
 
* smiles:
 
* smiles:
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 
* inchi-key:
 
* inchi-key:
** tzgxvfytktwkcu-cxxojbqzsa-l
+
** wvrzwraihitkpi-sokmhqjssa-n
 
* molecular-weight:
 
* molecular-weight:
** 346.422
+
** 909.472
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-163]]
+
* [[RXN-9362]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-162]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a15 (open lactone form)}}
+
{{#set: common-name=demethylmenaquinol-11}}
{{#set: inchi-key=inchikey=tzgxvfytktwkcu-cxxojbqzsa-l}}
+
{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
{{#set: molecular-weight=346.422}}
+
{{#set: molecular-weight=909.472}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-12120

  • common-name:
    • demethylmenaquinol-11
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
  • inchi-key:
    • wvrzwraihitkpi-sokmhqjssa-n
  • molecular-weight:
    • 909.472

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality