Difference between revisions of "Release-factor-L-glutamine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-126 == * common-name: ** γ-carotene * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c * i...")
(Created page with "Category:metabolite == Metabolite Release-factor-L-glutamine == * common-name: ** a [release factor]-l-glutamine == Reaction(s) known to consume the compound == * RXN-14...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-126 ==
+
== Metabolite Release-factor-L-glutamine ==
 
* common-name:
 
* common-name:
** γ-carotene
+
** a [release factor]-l-glutamine
* smiles:
 
** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)c)c)c)c)c
 
* inchi-key:
 
** hrqkoyfghjyefs-bxolysjbsa-n
 
* molecular-weight:
 
** 536.882
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-151]]
+
* [[RXN-14992]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-150]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-carotene}}
+
{{#set: common-name=a [release factor]-l-glutamine}}
{{#set: inchi-key=inchikey=hrqkoyfghjyefs-bxolysjbsa-n}}
 
{{#set: molecular-weight=536.882}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Release-factor-L-glutamine

  • common-name:
    • a [release factor]-l-glutamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [release factor]-l-glutamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.