Difference between revisions of "Release-factor-L-glutamine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite LINOLENOYL-COA == * common-name: ** α-linolenoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-]...")
(Created page with "Category:metabolite == Metabolite Release-factor-L-glutamine == * common-name: ** a [release factor]-l-glutamine == Reaction(s) known to consume the compound == * RXN-14...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite LINOLENOYL-COA ==
+
== Metabolite Release-factor-L-glutamine ==
 
* common-name:
 
* common-name:
** α-linolenoyl-coa
+
** a [release factor]-l-glutamine
* smiles:
 
** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
 
* inchi-key:
 
** omkfkbgzhnjnex-kzwmewpfsa-j
 
* molecular-weight:
 
** 1023.921
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13426]]
+
* [[RXN-14992]]
* [[RXN-13441]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LINOLENOYL-RXN]]
 
* [[LNLNCACOAL]]
 
* [[llcoas]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-linolenoyl-coa}}
+
{{#set: common-name=a [release factor]-l-glutamine}}
{{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}}
 
{{#set: molecular-weight=1023.921}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Release-factor-L-glutamine

  • common-name:
    • a [release factor]-l-glutamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [release factor]-l-glutamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.