Difference between revisions of "Release-factor-N5-Methyl-L-glutamine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12321 == * transcription-direction: ** negative * right-end-position: ** 286351 * left-end-position: ** 273813 * centisome-position: ** 76.04776...")
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * smiles: ** c(o)cccccccc=ccccccccc(=o)[o-] * inchi-key: ** lquhzvlttwmbto-uphrsur...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12321 ==
+
== Metabolite 18-HYDROXYOLEATE ==
* transcription-direction:
+
* common-name:
** negative
+
** 18-hydroxyoleate
* right-end-position:
+
* smiles:
** 286351
+
** c(o)cccccccc=ccccccccc(=o)[o-]
* left-end-position:
+
* inchi-key:
** 273813
+
** lquhzvlttwmbto-uphrsurjsa-m
* centisome-position:
+
* molecular-weight:
** 76.04776   
+
** 297.457
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16402]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RXN-6883]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=18-hydroxyoleate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}
** Category: [[orthology]]
+
{{#set: molecular-weight=297.457}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-4302]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=286351}}
 
{{#set: left-end-position=273813}}
 
{{#set: centisome-position=76.04776    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:34, 18 December 2020

Metabolite 18-HYDROXYOLEATE

  • common-name:
    • 18-hydroxyoleate
  • smiles:
    • c(o)cccccccc=ccccccccc(=o)[o-]
  • inchi-key:
    • lquhzvlttwmbto-uphrsurjsa-m
  • molecular-weight:
    • 297.457

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality