Difference between revisions of "Retinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15369 == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite Retinols == * common-name: ** a retinol == Reaction(s) known to consume the compound == * RETINOLSAT == Reaction(s) known to produce...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15369 ==
+
== Metabolite Retinols ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-lesqueroloyl-coa
+
** a retinol
* smiles:
 
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** chmqnmkvoyfhhx-sgpqcwjrsa-j
 
* molecular-weight:
 
** 1088.005
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14494]]
+
* [[RETINOLSAT]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14493]]
+
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
+
{{#set: common-name=a retinol}}
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
 
{{#set: molecular-weight=1088.005}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Retinols

  • common-name:
    • a retinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality