Difference between revisions of "Retinols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14405 == * common-name: ** 3r-hydroxy-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-dimethylguanine-26 == * common-name: ** an n2dimethylguanine26 in trna == Reaction(s) known to consume the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14405 ==
+
== Metabolite tRNA-Containing-N2-dimethylguanine-26 ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-dihomo γ-linolenoyl-coa
+
** an n2dimethylguanine26 in trna
* smiles:
 
** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** gfvfsxuaklzogc-nulwuihisa-j
 
* molecular-weight:
 
** 1067.974
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12969]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12968]]
+
* [[RXN-12376]]
 +
* [[RXN-12377]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=an n2dimethylguanine26 in trna}}
{{#set: inchi-key=inchikey=gfvfsxuaklzogc-nulwuihisa-j}}
 
{{#set: molecular-weight=1067.974}}
 

Revision as of 14:57, 5 January 2021

Metabolite tRNA-Containing-N2-dimethylguanine-26

  • common-name:
    • an n2dimethylguanine26 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality