Difference between revisions of "Rhodopsins"

Revision as of 08:26, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD1F-453 ==
+== Metabolite RIBOSE-1P ==
 * common-name:
-** kaempferol-3-glucoside
+** &alpha;-d-ribose-1-phosphate
 * smiles:
-** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
+** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
 * inchi-key:
-** jpukweqwgbddqb-qsofnflrsa-m
+** yxjdfqjkerbobm-txicztdvsa-l
 * molecular-weight:
-** 447.374
+** 228.095
 == Reaction(s) known to consume the compound ==
+* [[ADENPHOSPHOR-RXN]]
+* [[INOPHOSPHOR-RXN]]
+* [[PNP-RXN]]
+* [[PPENTOMUT-RXN]]
+* [[RXN-14456]]
+* [[RXN0-5199]]
+* [[URPHOS-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN1F-461]]
+* [[ADENPHOSPHOR-RXN]]
+* [[INOPHOSPHOR-RXN]]
+* [[PNP-RXN]]
+* [[PPENTOMUT-RXN]]
+* [[RXN-14456]]
+* [[RXN0-5199]]
+* [[URPHOS-RXN]]
+* [[XANTHOSINEPHOSPHORY-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=kaempferol-3-glucoside}}
+{{#set: common-name=&alpha;-d-ribose-1-phosphate}}
-{{#set: inchi-key=inchikey=jpukweqwgbddqb-qsofnflrsa-m}}
+{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
-{{#set: molecular-weight=447.374}}
+{{#set: molecular-weight=228.095}}