Difference between revisions of "Rhodopsins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-453 == * common-name: ** kaempferol-3-glucoside * smiles: ** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2)...")
(Created page with "Category:metabolite == Metabolite Rhodopsins == * common-name: ** a rhodopsin == Reaction(s) known to consume the compound == * 2.7.11.14-RXN == Reaction(s) known to p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-453 ==
+
== Metabolite Rhodopsins ==
 
* common-name:
 
* common-name:
** kaempferol-3-glucoside
+
** a rhodopsin
* smiles:
 
** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
 
* inchi-key:
 
** jpukweqwgbddqb-qsofnflrsa-m
 
* molecular-weight:
 
** 447.374
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.11.14-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-461]]
+
* [[2.7.11.14-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kaempferol-3-glucoside}}
+
{{#set: common-name=a rhodopsin}}
{{#set: inchi-key=inchikey=jpukweqwgbddqb-qsofnflrsa-m}}
 
{{#set: molecular-weight=447.374}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Rhodopsins

  • common-name:
    • a rhodopsin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality