Difference between revisions of "Rhodopsins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...") |
(Created page with "Category:metabolite == Metabolite Rhodopsins == * common-name: ** a rhodopsin == Reaction(s) known to consume the compound == * 2.7.11.14-RXN == Reaction(s) known to p...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Rhodopsins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a rhodopsin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.11.14-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.11.14-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a rhodopsin}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Rhodopsins
- common-name:
- a rhodopsin
