Difference between revisions of "Ribonucleoside-Diphosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIMP == * common-name: ** dimp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** phngfppxdjjadg-rrkc...") |
(Created page with "Category:metabolite == Metabolite Sugar == * common-name: ** a sugar == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * SU...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Sugar == |
* common-name: | * common-name: | ||
| − | ** | + | ** a sugar |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SUGAR-PHOSPHATASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a sugar}} |
| − | |||
| − | |||
Revision as of 15:27, 5 January 2021
Contents
Metabolite Sugar
- common-name:
- a sugar
