|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-AMINOTRANSFERASE-RXN ALANINE-AMINOTRANSFERASE-RXN] == | + | == Metabolite CPD-380 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** glutamate-pyruvate aminotransferase | + | ** 3-sulfopyruvate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.6.1.2 ec-2.6.1.2] | + | ** c(=o)([o-])c(=o)cs(=o)(=o)[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[PYRUVATE]][c]
| + | ** buthmsuebypmkj-uhfffaoysa-l |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ06815]]
| + | ** 166.105 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[R230-RXN]] |
| − | * Gene: [[SJ19809]] | + | * [[RXN-11737]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[R230-RXN]] |
| − | ** Category: [[orthology]]
| + | * [[RXN-11737]] |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: common-name=3-sulfopyruvate}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=166.105}} |
| − | * [[ALANINE-SYN2-PWY]], L-alanine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-SYN2-PWY ALANINE-SYN2-PWY] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[ALANINE-DEG3-PWY]], L-alanine degradation III: [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-DEG3-PWY ALANINE-DEG3-PWY] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[ALACAT2-PWY]], L-alanine degradation II (to D-lactate): [http://metacyc.org/META/NEW-IMAGE?object=ALACAT2-PWY ALACAT2-PWY]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
| |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-7383]], anaerobic energy metabolism (invertebrates, cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7383 PWY-7383]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19456 19456]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00258 R00258]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P13191 P13191]
| |
| − | ** [http://www.uniprot.org/uniprot/P25409 P25409]
| |
| − | ** [http://www.uniprot.org/uniprot/P24298 P24298]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9UR81 Q9UR81]
| |
| − | ** [http://www.uniprot.org/uniprot/P34106 P34106]
| |
| − | ** [http://www.uniprot.org/uniprot/P52894 P52894]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42685 Q42685]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=glutamate-pyruvate aminotransferase}} | |
| − | {{#set: ec-number=ec-2.6.1.2}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
| |
