Difference between revisions of "Ribonucleosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 4,5-bisphosphate == Reaction(s) known to co...") |
(Created page with "Category:metabolite == Metabolite CPD-16954 == * common-name: ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate * smiles: ** cc2(c(c(c)op(=o)([...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-16954 == |
* common-name: | * common-name: | ||
− | ** | + | ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate |
+ | * smiles: | ||
+ | ** cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2)) | ||
+ | * inchi-key: | ||
+ | ** pjdxuyncnwfpcz-iuyqgcfvsa-k | ||
+ | * molecular-weight: | ||
+ | ** 380.17 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15733]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate}} |
+ | {{#set: inchi-key=inchikey=pjdxuyncnwfpcz-iuyqgcfvsa-k}} | ||
+ | {{#set: molecular-weight=380.17}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-16954
- common-name:
- [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate
- smiles:
- cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- pjdxuyncnwfpcz-iuyqgcfvsa-k
- molecular-weight:
- 380.17
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.