Difference between revisions of "Ribonucleosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...")
(Created page with "Category:metabolite == Metabolite Ribonucleosides == * common-name: ** a ribonucleoside == Reaction(s) known to consume the compound == == Reaction(s) known to produce the...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NARINGENIN-CMPD ==
+
== Metabolite Ribonucleosides ==
 
* common-name:
 
* common-name:
** (2s)-naringenin
+
** a ribonucleoside
* smiles:
 
** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
 
* inchi-key:
 
** ftvwirxfelqlpi-zdusscgksa-n
 
* molecular-weight:
 
** 272.257
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[APIGNAR-RXN]]
+
* [[5-NUCLEOTID-RXN]]
 +
* [[RXN-17948]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-naringenin}}
+
{{#set: common-name=a ribonucleoside}}
{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
 
{{#set: molecular-weight=272.257}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Ribonucleosides

  • common-name:
    • a ribonucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality