Difference between revisions of "Ribonucleosides"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FORthi FORthi] == * direction: ** left-to-right * common-name: ** formate transport out via proton...") |
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite NARINGENIN-CMPD == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-naringenin |
| − | + | * smiles: | |
| − | * | + | ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) |
| − | == | + | * inchi-key: |
| − | * | + | ** ftvwirxfelqlpi-zdusscgksa-n |
| − | ** | + | * molecular-weight: |
| − | + | ** 272.257 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[APIGNAR-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=(2s)-naringenin}} |
| − | == | + | {{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}} |
| − | + | {{#set: molecular-weight=272.257}} | |
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite NARINGENIN-CMPD
- common-name:
- (2s)-naringenin
- smiles:
- c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
- inchi-key:
- ftvwirxfelqlpi-zdusscgksa-n
- molecular-weight:
- 272.257
