Difference between revisions of "S-1-PHENYLETHANOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21438 == * transcription-direction: ** positive * right-end-position: ** 313476 * left-end-position: ** 288663 * centisome-position: ** 48.172...")
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)co * inchi-key: ** awucvroldviajx-gsvougtgsa...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21438 ==
+
== Metabolite GLYCEROL-3P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** sn-glycerol 3-phosphate
−
* right-end-position:
+
* smiles:
−
** 313476
+
** c(op([o-])(=o)[o-])c(o)co
−
* left-end-position:
+
* inchi-key:
−
** 288663
+
** awucvroldviajx-gsvougtgsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 48.172   
+
** 170.058
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
== Reaction(s) associated ==
+
* [[G3PD2]]
−
* [[3.6.3.1-RXN]]
+
* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
−
** Category: [[annotation]]
+
* [[GLYCEROL-KIN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PHOSPHAGLYPSYN-RXN]]
−
* [[ATPASE-RXN]]
+
* [[RXN-10462]]
−
** Category: [[annotation]]
+
* [[RXN-13112]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13805]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-1381]]
−
** Category: [[annotation]]
+
* [[RXN-14965]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15045]]
−
* [[RXN-12195]]
+
* [[RXN-15740]]
−
** Category: [[annotation]]
+
* [[RXN-15745]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-16024]]
−
* [[RXN-12196]]
+
* [[RXN-16117]]
−
** Category: [[annotation]]
+
* [[RXN-17016]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-17017]]
−
* [[RXN0-5462]]
+
* [[RXN-17018]]
−
** Category: [[annotation]]
+
* [[RXN0-5260]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) associated ==
+
* [[1.1.1.8-RXN]]
−
* [[PWY-7210]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[G3PD2]]
−
* [[PWY-7198]]
+
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[GLYCEROL-KIN-RXN]]
−
* [[PWY-7184]]
+
* [[GLYCPDIESTER-RXN]]
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-13112]]
−
* [[PWY-6545]]
+
* [[RXN-13805]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN-14073]]
−
{{#set: transcription-direction=positive}}
+
* [[RXN-14136]]
−
{{#set: right-end-position=313476}}
+
* [[RXN-14160]]
−
{{#set: left-end-position=288663}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: centisome-position=48.172    }}
+
{{#set: common-name=sn-glycerol 3-phosphate}}
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
−
{{#set: nb reaction associated=6}}
+
{{#set: molecular-weight=170.058}}
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:33, 18 December 2020

Metabolite GLYCEROL-3P

  • common-name:
    • sn-glycerol 3-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c(o)co
  • inchi-key:
    • awucvroldviajx-gsvougtgsa-l
  • molecular-weight:
    • 170.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=S-1-PHENYLETHANOL&oldid=46912"