Difference between revisions of "S-24-DINITROPHENYLGLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DELTA-TOCOPHEROL == * common-name: ** δ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Crotonyl-ACPs == * common-name: ** a crotonyl-[acp] == Reaction(s) known to consume the compound == * RXN-9515 * RXN-9657 == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Crotonyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a crotonyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9515]] |
| + | * [[RXN-9657]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[4.2.1.58-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a crotonyl-[acp]}} |
| − | |||
| − | |||
Revision as of 11:19, 15 January 2021
Contents
Metabolite Crotonyl-ACPs
- common-name:
- a crotonyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a crotonyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
