Difference between revisions of "S-24-DINITROPHENYLGLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Crotonyl-ACPs == * common-name: ** a crotonyl-[acp] == Reaction(s) known to consume the compound == * RXN-9515 * RXN-9657 == Reac...") |
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-24-DINITROPHENYLGLUTATHIONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,4-dinitrophenyl-s-glutathione |
| + | * smiles: | ||
| + | ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1) | ||
| + | * inchi-key: | ||
| + | ** fxeukvkgtkddiq-uwvggrqhsa-m | ||
| + | * molecular-weight: | ||
| + | ** 472.406 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GST-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GST-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,4-dinitrophenyl-s-glutathione}} |
| + | {{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}} | ||
| + | {{#set: molecular-weight=472.406}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite S-24-DINITROPHENYLGLUTATHIONE
- common-name:
- 2,4-dinitrophenyl-s-glutathione
- smiles:
- c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
- inchi-key:
- fxeukvkgtkddiq-uwvggrqhsa-m
- molecular-weight:
- 472.406
